C18H17F5N6O3 — CID 167267495
1-[2-[5-[[[(1R)-1-(2,5-difluoro-3-pyridinyl)ethoxy]-hydroxymethyl]amino]-1-methylpyrazol-4-yl]pyrimidin-5-yl]-2,2,2-trifluoroethanol (PubChem CID 167267495) has the molecular formula C18H17F5N6O3 and a molecular weight of 460.36 g/mol. Its IUPAC name is 1-[2-[5-[[[(1R)-1-(2,5-difluoro-3-pyridinyl)ethoxy]-hydroxymethyl]amino]-1-methylpyrazol-4-yl]pyrimidin-5-yl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[2-[5-[[[(1R)-1-(2,5-difluoro-3-pyridinyl)ethoxy]-hydroxymethyl]amino]-1-methylpyrazol-4-yl]pyrimidin-5-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 167267495 |
| Molecular Formula | C18H17F5N6O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 1-[2-[5-[[[(1R)-1-(2,5-difluoro-3-pyridinyl)ethoxy]-hydroxymethyl]amino]-1-methylpyrazol-4-yl]pyrimidin-5-yl]-2,2,2-trifluoroethanol |
| SMILES | C[C@@H](OC(O)Nc1c(-c2ncc(C(O)C(F)(F)F)cn2)cnn1C)c1cc(F)cnc1F |
| InChI | InChI=1S/C18H17F5N6O3/c1-8(11-3-10(19)6-24-14(11)20)32-17(31)28-16-12(7-27-29(16)2)15-25-4-9(5-26-15)13(30)18(21,22)23/h3-8,13,17,28,30-31H,1-2H3/t8-,13?,17?/m1/s1 |
| InChIKey | NKFBLLVFUMBIDX-VBRZYTPASA-N |
| XLogP | 2.61 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|