C17H33N3 — CID 167267822
4-(7-methyltetradecan-7-yl)-1,2,4-triazole (PubChem CID 167267822) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 4-(7-methyltetradecan-7-yl)-1,2,4-triazole.
| Compound Name | 4-(7-methyltetradecan-7-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 167267822 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 4-(7-methyltetradecan-7-yl)-1,2,4-triazole |
| SMILES | CCCCCCCC(C)(CCCCCC)n1cnnc1 |
| InChI | InChI=1S/C17H33N3/c1-4-6-8-10-12-14-17(3,13-11-9-7-5-2)20-15-18-19-16-20/h15-16H,4-14H2,1-3H3 |
| InChIKey | HXVXABBVEMGBHH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|