C18H29N5O3 — CID 167268229
4-(2-azido-2-methylpropyl)-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]benzamide (PubChem CID 167268229) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-(2-azido-2-methylpropyl)-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 4-(2-azido-2-methylpropyl)-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 167268229 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 4-(2-azido-2-methylpropyl)-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CNCCOCCOCCNC(=O)c1ccc(CC(C)(C)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C18H29N5O3/c1-18(2,22-23-19)14-15-4-6-16(7-5-15)17(24)21-9-11-26-13-12-25-10-8-20-3/h4-7,20H,8-14H2,1-3H3,(H,21,24) |
| InChIKey | BBVRYXPKSDNKGW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|