C62H73Cl2FN8O10S — CID 167268461
CID 167268461 (PubChem CID 167268461) has the molecular formula C62H73Cl2FN8O10S and a molecular weight of 1212.28 g/mol.
| Compound Name | CID 167268461 |
|---|---|
| PubChem CID | 167268461 |
| Molecular Formula | C62H73Cl2FN8O10S |
| Molecular Weight | 1212.28 g/mol |
| Exact Mass | 1210.45 |
| IUPAC Name | — |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCOCCOCCOCCNCC(=O)c2ccc(NC(=O)[C@@H]3NC4(CCCCC4)[C@@]4(C(=O)Nc5cc(Cl)ccc54)[C@H]3c3cccc(Cl)c3F)cc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C62H73Cl2FN8O10S/c1-37-54(84-36-68-37)40-13-11-38(12-14-40)33-67-56(77)48-32-43(74)35-73(48)58(79)55(60(2,3)4)71-50(76)21-25-81-27-29-83-30-28-82-26-24-66-34-49(75)39-15-18-42(19-16-39)69-57(78)53-51(44-9-8-10-46(64)52(44)65)62(61(72-53)22-6-5-7-23-61)45-20-17-41(63)31-47(45)70-59(62)80/h8-20,31,36,43,48,51,53,55,66,72,74H,5-7,21-30,32-35H2,1-4H3,(H,67,77)(H,69,78)(H,70,80)(H,71,76)/t43-,48+,51+,53-,55-,62-/m1/s1 |
| InChIKey | RQAYIAVHPZMLRN-KVKGFIIOSA-N |
| XLogP | 7.87 |
| TPSA | 238.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 84 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1212.28 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|