C17H19NO6 — CID 16726888
trimethyl (2S,5S)-5-methyl-2-phenyl-1,2-dihydropyrrole-3,4,5-tricarboxylate (PubChem CID 16726888) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is trimethyl (2S,5S)-5-methyl-2-phenyl-1,2-dihydropyrrole-3,4,5-tricarboxylate.
| Compound Name | trimethyl (2S,5S)-5-methyl-2-phenyl-1,2-dihydropyrrole-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 16726888 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | trimethyl (2S,5S)-5-methyl-2-phenyl-1,2-dihydropyrrole-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@](C)(C(=O)OC)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19NO6/c1-17(16(21)24-4)12(15(20)23-3)11(14(19)22-2)13(18-17)10-8-6-5-7-9-10/h5-9,13,18H,1-4H3/t13-,17-/m0/s1 |
| InChIKey | YBMSIKQXZBTUOV-GUYCJALGSA-N |
| XLogP | 0.91 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|