About 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane
3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane (PubChem CID 167269391) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane.
Molecular Properties
| Compound Name | 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane |
| PubChem CID | 167269391 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane |
| SMILES | CCC1(COCCC2=CC3CC(C2)C3(C)C)COC1 |
| InChI | InChI=1S/C17H28O2/c1-4-17(11-19-12-17)10-18-6-5-13-7-14-9-15(8-13)16(14,2)3/h7,14-15H,4-6,8-12H2,1-3H3 |
| InChIKey | FTSNUVVQXPVRAS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane?
The IUPAC name of 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane (CID 167269391) is 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane.
What is the SMILES notation for 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane?
The canonical SMILES for 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane is CCC1(COCCC2=CC3CC(C2)C3(C)C)COC1.
What is the InChIKey of 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane?
The InChIKey is FTSNUVVQXPVRAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-4-17(11-19-12-17)10-18-6-5-13-7-14-9-15(8-13)16(14,2)3/h7,14-15H,4-6,8-12H2,1-3H3.
What are the key properties of 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane?
3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane has a molecular weight of 264.41 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl)ethoxymethyl]-3-ethyloxetane is sourced from PubChem (CID 167269391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).