C19H15F5O3 — CID 167270724
tert-butyl 5-ethenyl-2-(2,3,4,5,6-pentafluorophenoxy)benzoate (PubChem CID 167270724) has the molecular formula C19H15F5O3 and a molecular weight of 386.32 g/mol. Its IUPAC name is tert-butyl 5-ethenyl-2-(2,3,4,5,6-pentafluorophenoxy)benzoate.
| Compound Name | tert-butyl 5-ethenyl-2-(2,3,4,5,6-pentafluorophenoxy)benzoate |
|---|---|
| PubChem CID | 167270724 |
| Molecular Formula | C19H15F5O3 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | tert-butyl 5-ethenyl-2-(2,3,4,5,6-pentafluorophenoxy)benzoate |
| SMILES | C=Cc1ccc(Oc2c(F)c(F)c(F)c(F)c2F)c(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H15F5O3/c1-5-9-6-7-11(10(8-9)18(25)27-19(2,3)4)26-17-15(23)13(21)12(20)14(22)16(17)24/h5-8H,1H2,2-4H3 |
| InChIKey | BRAMGBXQKLMZGY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|