About 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole
4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole (PubChem CID 167271100) has the molecular formula C21H22N2O2S
and a molecular weight of 366.49 g/mol. Its IUPAC name is 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole.
Molecular Properties
| Compound Name | 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole |
| PubChem CID | 167271100 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole |
| SMILES | CC(C)c1ccc2c(c1)OC(CC(C)c1ccc(-c3csnn3)cc1)O2 |
| InChI | InChI=1S/C21H22N2O2S/c1-13(2)17-8-9-19-20(11-17)25-21(24-19)10-14(3)15-4-6-16(7-5-15)18-12-26-23-22-18/h4-9,11-14,21H,10H2,1-3H3 |
| InChIKey | YMYNJPMDUYGRHF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole?
The IUPAC name of 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole (CID 167271100) is 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole.
What is the SMILES notation for 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole?
The canonical SMILES for 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole is CC(C)c1ccc2c(c1)OC(CC(C)c1ccc(-c3csnn3)cc1)O2.
What is the InChIKey of 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole?
The InChIKey is YMYNJPMDUYGRHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2S/c1-13(2)17-8-9-19-20(11-17)25-21(24-19)10-14(3)15-4-6-16(7-5-15)18-12-26-23-22-18/h4-9,11-14,21H,10H2,1-3H3.
What are the key properties of 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole?
4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole has a molecular weight of 366.49 g/mol, XLogP of 5.62, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[1-(5-propan-2-yl-1,3-benzodioxol-2-yl)propan-2-yl]phenyl]thiadiazole is sourced from PubChem (CID 167271100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).