C23H32N4O2S — CID 16727121
[4-[(3aS,3bS,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-1,3-thiazol-2-yl]urea (PubChem CID 16727121) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is [4-[(3aS,3bS,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-1,3-thiazol-2-yl]urea.
| Compound Name | [4-[(3aS,3bS,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 16727121 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [4-[(3aS,3bS,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]-1,3-thiazol-2-yl]urea |
| SMILES | CN1C(=O)C=C[C@@]2(C)C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3csc(NC(N)=O)n3)CC[C@@H]12 |
| InChI | InChI=1S/C23H32N4O2S/c1-22-10-8-15-13(4-7-18-23(15,2)11-9-19(28)27(18)3)14(22)5-6-16(22)17-12-30-21(25-17)26-20(24)29/h9,11-16,18H,4-8,10H2,1-3H3,(H3,24,25,26,29)/t13-,14-,15-,16?,18?,22-,23+/m0/s1 |
| InChIKey | KBEMXERFPWJRFQ-ZGXGWQHNSA-N |
| XLogP | 4.36 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |