C20H16N4O — CID 16727122
19-methyl-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17,20-octaen-14-one (PubChem CID 16727122) has the molecular formula C20H16N4O and a molecular weight of 328.37 g/mol. Its IUPAC name is 19-methyl-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17,20-octaen-14-one.
| Compound Name | 19-methyl-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17,20-octaen-14-one |
|---|---|
| PubChem CID | 16727122 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 19-methyl-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,6,8,11(15),17,20-octaen-14-one |
| SMILES | Cn1cc2c(n1)CCc1c-2c2c(c3c1[nH]c1ccccc13)CNC2=O |
| InChI | InChI=1S/C20H16N4O/c1-24-9-13-15(23-24)7-6-11-16(13)18-12(8-21-20(18)25)17-10-4-2-3-5-14(10)22-19(11)17/h2-5,9,22H,6-8H2,1H3,(H,21,25) |
| InChIKey | GOPWMXCRSJOJRB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |