C27H35N5O5S3 — CID 167271440
1-[2-(8-oxooctanoylamino)ethyl]-N-[6-(thiophen-2-ylsulfonylamino)-1,3-benzothiazol-2-yl]piperidine-4-carboxamide (PubChem CID 167271440) has the molecular formula C27H35N5O5S3 and a molecular weight of 605.81 g/mol. Its IUPAC name is 1-[2-(8-oxooctanoylamino)ethyl]-N-[6-(thiophen-2-ylsulfonylamino)-1,3-benzothiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(8-oxooctanoylamino)ethyl]-N-[6-(thiophen-2-ylsulfonylamino)-1,3-benzothiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167271440 |
| Molecular Formula | C27H35N5O5S3 |
| Molecular Weight | 605.81 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | 1-[2-(8-oxooctanoylamino)ethyl]-N-[6-(thiophen-2-ylsulfonylamino)-1,3-benzothiazol-2-yl]piperidine-4-carboxamide |
| SMILES | O=CCCCCCCC(=O)NCCN1CCC(C(=O)Nc2nc3ccc(NS(=O)(=O)c4cccs4)cc3s2)CC1 |
| InChI | InChI=1S/C27H35N5O5S3/c33-17-5-3-1-2-4-7-24(34)28-13-16-32-14-11-20(12-15-32)26(35)30-27-29-22-10-9-21(19-23(22)39-27)31-40(36,37)25-8-6-18-38-25/h6,8-10,17-20,31H,1-5,7,11-16H2,(H,28,34)(H,29,30,35) |
| InChIKey | IKPJOXUZAXSSJO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|