About 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide
1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide (PubChem CID 167272241) has the molecular formula C8H15NO2S2
and a molecular weight of 221.35 g/mol. Its IUPAC name is 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide.
Molecular Properties
| Compound Name | 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide |
| PubChem CID | 167272241 |
| Molecular Formula | C8H15NO2S2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide |
| SMILES | CS(C)(C)C#CC1(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C8H15NO2S2/c1-12(2,3)7-6-8(4-5-8)13(9,10)11/h4-5H2,1-3H3,(H2,9,10,11) |
| InChIKey | MWVDOANTGLMVBS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide?
The IUPAC name of 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide (CID 167272241) is 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide.
What is the SMILES notation for 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide?
The canonical SMILES for 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide is CS(C)(C)C#CC1(S(N)(=O)=O)CC1.
What is the InChIKey of 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide?
The InChIKey is MWVDOANTGLMVBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S2/c1-12(2,3)7-6-8(4-5-8)13(9,10)11/h4-5H2,1-3H3,(H2,9,10,11).
What are the key properties of 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide?
1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide has a molecular weight of 221.35 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(trimethyl-λ4-sulfanyl)ethynyl]cyclopropane-1-sulfonamide is sourced from PubChem (CID 167272241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).