About 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine
8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine (PubChem CID 167272448) has the molecular formula C9H9ClFN5
and a molecular weight of 241.66 g/mol. Its IUPAC name is 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine.
Molecular Properties
| Compound Name | 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine |
| PubChem CID | 167272448 |
| Molecular Formula | C9H9ClFN5 |
| Molecular Weight | 241.66 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine |
| SMILES | CN(N)c1c(N)nc(Cl)c2cc(F)cnc12 |
| InChI | InChI=1S/C9H9ClFN5/c1-16(13)7-6-5(2-4(11)3-14-6)8(10)15-9(7)12/h2-3H,13H2,1H3,(H2,12,15) |
| InChIKey | VRDPBFYNDYDIKA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.66 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine?
The IUPAC name of 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine (CID 167272448) is 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine.
What is the SMILES notation for 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine?
The canonical SMILES for 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine is CN(N)c1c(N)nc(Cl)c2cc(F)cnc12.
What is the InChIKey of 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine?
The InChIKey is VRDPBFYNDYDIKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClFN5/c1-16(13)7-6-5(2-4(11)3-14-6)8(10)15-9(7)12/h2-3H,13H2,1H3,(H2,12,15).
What are the key properties of 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine?
8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine has a molecular weight of 241.66 g/mol, XLogP of 1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[amino(methyl)amino]-5-chloro-3-fluoro-1,6-naphthyridin-7-amine is sourced from PubChem (CID 167272448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).