C35H49F2NO6 — CID 167272607
[(3aR,6aS,8R,10R,10aR)-3a,10a-dihydroxy-5-(hydroxymethyl)-2,7,7,8,10-pentamethyl-3-oxo-6a,9,10,10b-tetrahydro-4H-benzo[e]azulen-8-yl] 2-amino-8-[4-(difluoromethyl)phenyl]octanoate (PubChem CID 167272607) has the molecular formula C35H49F2NO6 and a molecular weight of 617.77 g/mol. Its IUPAC name is [(3aR,6aS,8R,10R,10aR)-3a,10a-dihydroxy-5-(hydroxymethyl)-2,7,7,8,10-pentamethyl-3-oxo-6a,9,10,10b-tetrahydro-4H-benzo[e]azulen-8-yl] 2-amino-8-[4-(difluoromethyl)phenyl]octanoate.
| Compound Name | [(3aR,6aS,8R,10R,10aR)-3a,10a-dihydroxy-5-(hydroxymethyl)-2,7,7,8,10-pentamethyl-3-oxo-6a,9,10,10b-tetrahydro-4H-benzo[e]azulen-8-yl] 2-amino-8-[4-(difluoromethyl)phenyl]octanoate |
|---|---|
| PubChem CID | 167272607 |
| Molecular Formula | C35H49F2NO6 |
| Molecular Weight | 617.77 g/mol |
| Exact Mass | 617.35 |
| IUPAC Name | [(3aR,6aS,8R,10R,10aR)-3a,10a-dihydroxy-5-(hydroxymethyl)-2,7,7,8,10-pentamethyl-3-oxo-6a,9,10,10b-tetrahydro-4H-benzo[e]azulen-8-yl] 2-amino-8-[4-(difluoromethyl)phenyl]octanoate |
| SMILES | CC1=CC2[C@@]3(O)[C@H](C)C[C@@](C)(OC(=O)C(N)CCCCCCc4ccc(C(F)F)cc4)C(C)(C)[C@@H]3C=C(CO)C[C@]2(O)C1=O |
| InChI | InChI=1S/C35H49F2NO6/c1-21-16-28-34(42,29(21)40)19-24(20-39)17-27-32(3,4)33(5,18-22(2)35(27,28)43)44-31(41)26(38)11-9-7-6-8-10-23-12-14-25(15-13-23)30(36)37/h12-17,22,26-28,30,39,42-43H,6-11,18-20,38H2,1-5H3/t22-,26?,27+,28?,33-,34-,35-/m1/s1 |
| InChIKey | UESQOHDBWHDAOQ-DKSYGCIZSA-N |
| XLogP | 5.36 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.77 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|