About 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline
3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline (PubChem CID 167273261) has the molecular formula C13H18F2N2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline.
Molecular Properties
| Compound Name | 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline |
| PubChem CID | 167273261 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline |
| SMILES | CNc1cc(C)cc(N2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C13H18F2N2/c1-10-7-11(16-2)9-12(8-10)17-5-3-13(14,15)4-6-17/h7-9,16H,3-6H2,1-2H3 |
| InChIKey | JQTGILSLKUXDOT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline?
The IUPAC name of 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline (CID 167273261) is 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline.
What is the SMILES notation for 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline?
The canonical SMILES for 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline is CNc1cc(C)cc(N2CCC(F)(F)CC2)c1.
What is the InChIKey of 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline?
The InChIKey is JQTGILSLKUXDOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N2/c1-10-7-11(16-2)9-12(8-10)17-5-3-13(14,15)4-6-17/h7-9,16H,3-6H2,1-2H3.
What are the key properties of 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline?
3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline has a molecular weight of 240.30 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-difluoropiperidin-1-yl)-N,5-dimethylaniline is sourced from PubChem (CID 167273261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).