C20H34S — CID 167274344
(3E,5E)-6-ethenyl-7-ethyl-7-methyl-3-(3-methylpentan-3-ylsulfanyl)nona-1,3,5-triene (PubChem CID 167274344) has the molecular formula C20H34S and a molecular weight of 306.56 g/mol. Its IUPAC name is (3E,5E)-6-ethenyl-7-ethyl-7-methyl-3-(3-methylpentan-3-ylsulfanyl)nona-1,3,5-triene.
| Compound Name | (3E,5E)-6-ethenyl-7-ethyl-7-methyl-3-(3-methylpentan-3-ylsulfanyl)nona-1,3,5-triene |
|---|---|
| PubChem CID | 167274344 |
| Molecular Formula | C20H34S |
| Molecular Weight | 306.56 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | (3E,5E)-6-ethenyl-7-ethyl-7-methyl-3-(3-methylpentan-3-ylsulfanyl)nona-1,3,5-triene |
| SMILES | C=C/C(=C\C=C(/C=C)C(C)(CC)CC)SC(C)(CC)CC |
| InChI | InChI=1S/C20H34S/c1-9-17(19(7,11-3)12-4)15-16-18(10-2)21-20(8,13-5)14-6/h9-10,15-16H,1-2,11-14H2,3-8H3/b17-15+,18-16+ |
| InChIKey | QUWOBYRVXXKXRO-YTEMWHBBSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.56 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|