About N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine
N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine (PubChem CID 16727464) has the molecular formula C12H28N2O4S2
and a molecular weight of 328.50 g/mol. Its IUPAC name is N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine |
| PubChem CID | 16727464 |
| Molecular Formula | C12H28N2O4S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine |
| SMILES | CCC(CS(C)(=O)=O)NCCNC(CC)CS(C)(=O)=O |
| InChI | InChI=1S/C12H28N2O4S2/c1-5-11(9-19(3,15)16)13-7-8-14-12(6-2)10-20(4,17)18/h11-14H,5-10H2,1-4H3 |
| InChIKey | AIGVXDMWBNPIFQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine?
The IUPAC name of N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine (CID 16727464) is N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine?
The canonical SMILES for N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine is CCC(CS(C)(=O)=O)NCCNC(CC)CS(C)(=O)=O.
What is the InChIKey of N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine?
The InChIKey is AIGVXDMWBNPIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2O4S2/c1-5-11(9-19(3,15)16)13-7-8-14-12(6-2)10-20(4,17)18/h11-14H,5-10H2,1-4H3.
What are the key properties of N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine?
N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine has a molecular weight of 328.50 g/mol, XLogP of -0.19, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(1-methylsulfonylbutan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 16727464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).