C16H18N3O6P — CID 16727472
1-[(3aR,8aS)-6-oxo-6-phenoxy-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-2-yl]-4-aminopyrimidin-2-one (PubChem CID 16727472) has the molecular formula C16H18N3O6P and a molecular weight of 379.31 g/mol. Its IUPAC name is 1-[(3aR,8aS)-6-oxo-6-phenoxy-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-2-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(3aR,8aS)-6-oxo-6-phenoxy-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-2-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 16727472 |
| Molecular Formula | C16H18N3O6P |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-[(3aR,8aS)-6-oxo-6-phenoxy-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-2-yl]-4-aminopyrimidin-2-one |
| SMILES | Nc1ccn(C2C[C@@H]3COP(=O)(Oc4ccccc4)OC[C@H]3O2)c(=O)n1 |
| InChI | InChI=1S/C16H18N3O6P/c17-14-6-7-19(16(20)18-14)15-8-11-9-22-26(21,23-10-13(11)24-15)25-12-4-2-1-3-5-12/h1-7,11,13,15H,8-10H2,(H2,17,18,20)/t11-,13-,15?,26?/m1/s1 |
| InChIKey | GDLMWLBTQVPEEK-QKKOOYGGSA-N |
| XLogP | 1.96 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|