About N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide
N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide (PubChem CID 167275060) has the molecular formula C22H22N4O
and a molecular weight of 358.45 g/mol. Its IUPAC name is N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide.
Molecular Properties
| Compound Name | N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide |
| PubChem CID | 167275060 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide |
| SMILES | CNCc1ccc(CNC(=O)Cn2c3ccccc3c3cccnc32)cc1 |
| InChI | InChI=1S/C22H22N4O/c1-23-13-16-8-10-17(11-9-16)14-25-21(27)15-26-20-7-3-2-5-18(20)19-6-4-12-24-22(19)26/h2-12,23H,13-15H2,1H3,(H,25,27) |
| InChIKey | HSVKCWPYBSKWPK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide?
The IUPAC name of N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide (CID 167275060) is N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide.
What is the SMILES notation for N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide?
The canonical SMILES for N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide is CNCc1ccc(CNC(=O)Cn2c3ccccc3c3cccnc32)cc1.
What is the InChIKey of N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide?
The InChIKey is HSVKCWPYBSKWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O/c1-23-13-16-8-10-17(11-9-16)14-25-21(27)15-26-20-7-3-2-5-18(20)19-6-4-12-24-22(19)26/h2-12,23H,13-15H2,1H3,(H,25,27).
What are the key properties of N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide?
N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide has a molecular weight of 358.45 g/mol, XLogP of 3.23, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(methylaminomethyl)phenyl]methyl]-2-pyrido[2,3-b]indol-9-ylacetamide is sourced from PubChem (CID 167275060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).