C18H23N3O — CID 16727575
5,7-ditert-butyl-2-(1H-pyrazol-5-yl)-1,3-benzoxazole (PubChem CID 16727575) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 5,7-ditert-butyl-2-(1H-pyrazol-5-yl)-1,3-benzoxazole.
| Compound Name | 5,7-ditert-butyl-2-(1H-pyrazol-5-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 16727575 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 5,7-ditert-butyl-2-(1H-pyrazol-5-yl)-1,3-benzoxazole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(-c3ccn[nH]3)nc2c1 |
| InChI | InChI=1S/C18H23N3O/c1-17(2,3)11-9-12(18(4,5)6)15-14(10-11)20-16(22-15)13-7-8-19-21-13/h7-10H,1-6H3,(H,19,21) |
| InChIKey | IZHWPONRNPTSOZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |