C22H32N2O2 — CID 167276423
(2Z,4Z)-6-amino-2-ethyl-N-[2-(4-phenylcyclohexyl)oxyethyl]hexa-2,4-dienamide (PubChem CID 167276423) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (2Z,4Z)-6-amino-2-ethyl-N-[2-(4-phenylcyclohexyl)oxyethyl]hexa-2,4-dienamide.
| Compound Name | (2Z,4Z)-6-amino-2-ethyl-N-[2-(4-phenylcyclohexyl)oxyethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 167276423 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | (2Z,4Z)-6-amino-2-ethyl-N-[2-(4-phenylcyclohexyl)oxyethyl]hexa-2,4-dienamide |
| SMILES | CC/C(=C/C=C\CN)C(=O)NCCOC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H32N2O2/c1-2-18(8-6-7-15-23)22(25)24-16-17-26-21-13-11-20(12-14-21)19-9-4-3-5-10-19/h3-10,20-21H,2,11-17,23H2,1H3,(H,24,25)/b7-6-,18-8- |
| InChIKey | QLWOSTMGIMZBGP-AXEMHIPPSA-N |
| XLogP | 3.70 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|