C24H33NO4 — CID 167276474
3-(4-spiro[1,2,4-trioxonane-3,2'-adamantane]-6-ylphenyl)propanamide (PubChem CID 167276474) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is 3-(4-spiro[1,2,4-trioxonane-3,2'-adamantane]-6-ylphenyl)propanamide.
| Compound Name | 3-(4-spiro[1,2,4-trioxonane-3,2'-adamantane]-6-ylphenyl)propanamide |
|---|---|
| PubChem CID | 167276474 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 3-(4-spiro[1,2,4-trioxonane-3,2'-adamantane]-6-ylphenyl)propanamide |
| SMILES | NC(=O)CCc1ccc(C2CCCOOC3(OC2)C2CC4CC(C2)CC3C4)cc1 |
| InChI | InChI=1S/C24H33NO4/c25-23(26)8-5-16-3-6-19(7-4-16)20-2-1-9-28-29-24(27-15-20)21-11-17-10-18(13-21)14-22(24)12-17/h3-4,6-7,17-18,20-22H,1-2,5,8-15H2,(H2,25,26) |
| InChIKey | KDRMXNQEEHQYJM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|