C16H26O6 — CID 167276702
tert-butyl (E,6R)-6-[[(6R)-4-hydroxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]oxy]hept-2-enoate (PubChem CID 167276702) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is tert-butyl (E,6R)-6-[[(6R)-4-hydroxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]oxy]hept-2-enoate.
| Compound Name | tert-butyl (E,6R)-6-[[(6R)-4-hydroxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]oxy]hept-2-enoate |
|---|---|
| PubChem CID | 167276702 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tert-butyl (E,6R)-6-[[(6R)-4-hydroxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]oxy]hept-2-enoate |
| SMILES | C[C@H](CC/C=C/C(=O)OC(C)(C)C)OC1OC2O[C@@H]2CC1O |
| InChI | InChI=1S/C16H26O6/c1-10(7-5-6-8-13(18)22-16(2,3)4)19-14-11(17)9-12-15(20-12)21-14/h6,8,10-12,14-15,17H,5,7,9H2,1-4H3/b8-6+/t10-,11?,12-,14?,15?/m1/s1 |
| InChIKey | BSADRVSYSXPOOO-STSODLIZSA-N |
| XLogP | 1.90 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|