About 3-propyl-5H-chromeno[2,3-b]pyridine
3-propyl-5H-chromeno[2,3-b]pyridine (PubChem CID 167276732) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-propyl-5H-chromeno[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-propyl-5H-chromeno[2,3-b]pyridine |
| PubChem CID | 167276732 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-propyl-5H-chromeno[2,3-b]pyridine |
| SMILES | CCCc1cnc2c(c1)Cc1ccccc1O2 |
| InChI | InChI=1S/C15H15NO/c1-2-5-11-8-13-9-12-6-3-4-7-14(12)17-15(13)16-10-11/h3-4,6-8,10H,2,5,9H2,1H3 |
| InChIKey | URCARHYXWQCZAI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propyl-5H-chromeno[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-5H-chromeno[2,3-b]pyridine?
The IUPAC name of 3-propyl-5H-chromeno[2,3-b]pyridine (CID 167276732) is 3-propyl-5H-chromeno[2,3-b]pyridine.
What is the SMILES notation for 3-propyl-5H-chromeno[2,3-b]pyridine?
The canonical SMILES for 3-propyl-5H-chromeno[2,3-b]pyridine is CCCc1cnc2c(c1)Cc1ccccc1O2.
What is the InChIKey of 3-propyl-5H-chromeno[2,3-b]pyridine?
The InChIKey is URCARHYXWQCZAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c1-2-5-11-8-13-9-12-6-3-4-7-14(12)17-15(13)16-10-11/h3-4,6-8,10H,2,5,9H2,1H3.
What are the key properties of 3-propyl-5H-chromeno[2,3-b]pyridine?
3-propyl-5H-chromeno[2,3-b]pyridine has a molecular weight of 225.29 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-5H-chromeno[2,3-b]pyridine is sourced from PubChem (CID 167276732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).