About N-propylidenebutanamide
N-propylidenebutanamide (PubChem CID 167276769) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is N-propylidenebutanamide.
Molecular Properties
| Compound Name | N-propylidenebutanamide |
| PubChem CID | 167276769 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | N-propylidenebutanamide |
| SMILES | CC/C=N/C(=O)CCC |
| InChI | InChI=1S/C7H13NO/c1-3-5-7(9)8-6-4-2/h6H,3-5H2,1-2H3/b8-6+ |
| InChIKey | VRVJHODRMRIOFO-SOFGYWHQSA-N |
| XLogP | 1.79 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-propylidenebutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylidenebutanamide?
The IUPAC name of N-propylidenebutanamide (CID 167276769) is N-propylidenebutanamide.
What is the SMILES notation for N-propylidenebutanamide?
The canonical SMILES for N-propylidenebutanamide is CC/C=N/C(=O)CCC.
What is the InChIKey of N-propylidenebutanamide?
The InChIKey is VRVJHODRMRIOFO-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H13NO/c1-3-5-7(9)8-6-4-2/h6H,3-5H2,1-2H3/b8-6+.
What are the key properties of N-propylidenebutanamide?
N-propylidenebutanamide has a molecular weight of 127.19 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylidenebutanamide is sourced from PubChem (CID 167276769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).