About 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol
2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol (PubChem CID 16727722) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol.
Molecular Properties
| Compound Name | 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol |
| PubChem CID | 16727722 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol |
| SMILES | CCCCCCCN1CCc2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C16H25NO2/c1-2-3-4-5-6-8-17-9-7-13-10-15(18)16(19)11-14(13)12-17/h10-11,18-19H,2-9,12H2,1H3 |
| InChIKey | NPOMEWIFJUKGMV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol?
The IUPAC name of 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol (CID 16727722) is 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol.
What is the SMILES notation for 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol?
The canonical SMILES for 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol is CCCCCCCN1CCc2cc(O)c(O)cc2C1.
What is the InChIKey of 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol?
The InChIKey is NPOMEWIFJUKGMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-2-3-4-5-6-8-17-9-7-13-10-15(18)16(19)11-14(13)12-17/h10-11,18-19H,2-9,12H2,1H3.
What are the key properties of 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol?
2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol has a molecular weight of 263.38 g/mol, XLogP of 3.43, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-3,4-dihydro-1H-isoquinoline-6,7-diol is sourced from PubChem (CID 16727722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).