C13H16O3 — CID 16727779
(3R,6R)-3-methyl-6-(phenylmethoxymethyl)-3,6-dihydro-1,2-dioxine (PubChem CID 16727779) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (3R,6R)-3-methyl-6-(phenylmethoxymethyl)-3,6-dihydro-1,2-dioxine.
| Compound Name | (3R,6R)-3-methyl-6-(phenylmethoxymethyl)-3,6-dihydro-1,2-dioxine |
|---|---|
| PubChem CID | 16727779 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (3R,6R)-3-methyl-6-(phenylmethoxymethyl)-3,6-dihydro-1,2-dioxine |
| SMILES | C[C@@H]1C=C[C@H](COCc2ccccc2)OO1 |
| InChI | InChI=1S/C13H16O3/c1-11-7-8-13(16-15-11)10-14-9-12-5-3-2-4-6-12/h2-8,11,13H,9-10H2,1H3/t11-,13-/m1/s1 |
| InChIKey | MONNHGUUAWMHEM-DGCLKSJQSA-N |
| XLogP | 2.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|