C10H18O3 — CID 16727788
(1R,6S)-1-hexyl-3,4,7-trioxabicyclo[4.1.0]heptane (PubChem CID 16727788) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (1R,6S)-1-hexyl-3,4,7-trioxabicyclo[4.1.0]heptane.
| Compound Name | (1R,6S)-1-hexyl-3,4,7-trioxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 16727788 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (1R,6S)-1-hexyl-3,4,7-trioxabicyclo[4.1.0]heptane |
| SMILES | CCCCCC[C@@]12COOC[C@@H]1O2 |
| InChI | InChI=1S/C10H18O3/c1-2-3-4-5-6-10-8-12-11-7-9(10)13-10/h9H,2-8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | KNZCXZVYHJACPH-VHSXEESVSA-N |
| XLogP | 2.06 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|