C24H30O4 — CID 167278284
methyl 4-[(3S,4E,6Z,8E,12Z)-3-formylpentadeca-4,6,8,12-tetraenoxy]benzoate (PubChem CID 167278284) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is methyl 4-[(3S,4E,6Z,8E,12Z)-3-formylpentadeca-4,6,8,12-tetraenoxy]benzoate.
| Compound Name | methyl 4-[(3S,4E,6Z,8E,12Z)-3-formylpentadeca-4,6,8,12-tetraenoxy]benzoate |
|---|---|
| PubChem CID | 167278284 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | methyl 4-[(3S,4E,6Z,8E,12Z)-3-formylpentadeca-4,6,8,12-tetraenoxy]benzoate |
| SMILES | CC/C=C\CC/C=C/C=C\C=C\[C@@H](C=O)CCOc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C24H30O4/c1-3-4-5-6-7-8-9-10-11-12-13-21(20-25)18-19-28-23-16-14-22(15-17-23)24(26)27-2/h4-5,8-17,20-21H,3,6-7,18-19H2,1-2H3/b5-4-,9-8+,11-10-,13-12+/t21-/m1/s1 |
| InChIKey | VARJURUUZWMZNU-NIBPKQGHSA-N |
| XLogP | 5.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|