C17H27F — CID 167278340
1-[(2R,3Z,5E)-5-fluorohepta-3,5-dien-2-yl]-1-methyl-2-propylidenecyclohexane (PubChem CID 167278340) has the molecular formula C17H27F and a molecular weight of 250.40 g/mol. Its IUPAC name is 1-[(2R,3Z,5E)-5-fluorohepta-3,5-dien-2-yl]-1-methyl-2-propylidenecyclohexane.
| Compound Name | 1-[(2R,3Z,5E)-5-fluorohepta-3,5-dien-2-yl]-1-methyl-2-propylidenecyclohexane |
|---|---|
| PubChem CID | 167278340 |
| Molecular Formula | C17H27F |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 1-[(2R,3Z,5E)-5-fluorohepta-3,5-dien-2-yl]-1-methyl-2-propylidenecyclohexane |
| SMILES | C/C=C(F)\C=C/[C@@H](C)C1(C)CCCCC1=CCC |
| InChI | InChI=1S/C17H27F/c1-5-9-15-10-7-8-13-17(15,4)14(3)11-12-16(18)6-2/h6,9,11-12,14H,5,7-8,10,13H2,1-4H3/b12-11-,15-9?,16-6+/t14-,17?/m1/s1 |
| InChIKey | PTMJBSPESQCHFT-NVLZTXNWSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|