About 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole
4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole (PubChem CID 167278856) has the molecular formula C10H13F2N5
and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole.
Molecular Properties
| Compound Name | 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole |
| PubChem CID | 167278856 |
| Molecular Formula | C10H13F2N5 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole |
| SMILES | Cc1nn(C)nc1Cc1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C10H13F2N5/c1-7-9(15-16(2)14-7)3-8-4-13-17(5-8)6-10(11)12/h4-5,10H,3,6H2,1-2H3 |
| InChIKey | FOJBWCCWKUWRAD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole?
The IUPAC name of 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole (CID 167278856) is 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole.
What is the SMILES notation for 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole?
The canonical SMILES for 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole is Cc1nn(C)nc1Cc1cnn(CC(F)F)c1.
What is the InChIKey of 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole?
The InChIKey is FOJBWCCWKUWRAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2N5/c1-7-9(15-16(2)14-7)3-8-4-13-17(5-8)6-10(11)12/h4-5,10H,3,6H2,1-2H3.
What are the key properties of 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole?
4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole has a molecular weight of 241.25 g/mol, XLogP of 1.18, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-2,5-dimethyltriazole is sourced from PubChem (CID 167278856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).