C23H41NO2 — CID 167278973
(7R)-2-(5-tert-butyl-1,5-dimethylcyclooctyl)-7-hydroxy-1,1-dimethyl-5,6,7,8-tetrahydro-2H-pyrrolizin-3-one (PubChem CID 167278973) has the molecular formula C23H41NO2 and a molecular weight of 363.59 g/mol. Its IUPAC name is (7R)-2-(5-tert-butyl-1,5-dimethylcyclooctyl)-7-hydroxy-1,1-dimethyl-5,6,7,8-tetrahydro-2H-pyrrolizin-3-one.
| Compound Name | (7R)-2-(5-tert-butyl-1,5-dimethylcyclooctyl)-7-hydroxy-1,1-dimethyl-5,6,7,8-tetrahydro-2H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 167278973 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | (7R)-2-(5-tert-butyl-1,5-dimethylcyclooctyl)-7-hydroxy-1,1-dimethyl-5,6,7,8-tetrahydro-2H-pyrrolizin-3-one |
| SMILES | CC1(C2C(=O)N3CC[C@@H](O)C3C2(C)C)CCCC(C)(C(C)(C)C)CCC1 |
| InChI | InChI=1S/C23H41NO2/c1-20(2,3)23(7)13-8-11-22(6,12-9-14-23)17-19(26)24-15-10-16(25)18(24)21(17,4)5/h16-18,25H,8-15H2,1-7H3/t16-,17?,18?,22?,23?/m1/s1 |
| InChIKey | BIDXSVZCVSMABX-RZXBYNTASA-N |
| XLogP | 5.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |