About ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate
ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate (PubChem CID 16727934) has the molecular formula C17H19NO4S
and a molecular weight of 333.41 g/mol. Its IUPAC name is ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate.
Molecular Properties
| Compound Name | ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate |
| PubChem CID | 16727934 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSC1=C(NC(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H19NO4S/c1-4-22-13(19)9-23-17-14(18-10(2)3)15(20)11-7-5-6-8-12(11)16(17)21/h5-8,10,18H,4,9H2,1-3H3 |
| InChIKey | NNVZADXNJPLYOE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate?
The IUPAC name of ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate (CID 16727934) is ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate.
What is the SMILES notation for ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate?
The canonical SMILES for ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate is CCOC(=O)CSC1=C(NC(C)C)C(=O)c2ccccc2C1=O.
What is the InChIKey of ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate?
The InChIKey is NNVZADXNJPLYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4S/c1-4-22-13(19)9-23-17-14(18-10(2)3)15(20)11-7-5-6-8-12(11)16(17)21/h5-8,10,18H,4,9H2,1-3H3.
What are the key properties of ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate?
ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate has a molecular weight of 333.41 g/mol, XLogP of 2.57, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1,4-dioxo-3-(propan-2-ylamino)naphthalen-2-yl]sulfanylacetate is sourced from PubChem (CID 16727934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).