C35H70N10O4 — CID 16727949
N-[(2S)-1-[3-[[(2S)-2-(decanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]decanamide (PubChem CID 16727949) has the molecular formula C35H70N10O4 and a molecular weight of 695.01 g/mol. Its IUPAC name is N-[(2S)-1-[3-[[(2S)-2-(decanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]decanamide.
| Compound Name | N-[(2S)-1-[3-[[(2S)-2-(decanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]decanamide |
|---|---|
| PubChem CID | 16727949 |
| Molecular Formula | C35H70N10O4 |
| Molecular Weight | 695.01 g/mol |
| Exact Mass | 694.56 |
| IUPAC Name | N-[(2S)-1-[3-[[(2S)-2-(decanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]propylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@@H](CCCN=C(N)N)C(=O)NCCCNC(=O)[C@H](CCCN=C(N)N)NC(=O)CCCCCCCCC |
| InChI | InChI=1S/C35H70N10O4/c1-3-5-7-9-11-13-15-22-30(46)44-28(20-17-24-42-34(36)37)32(48)40-26-19-27-41-33(49)29(21-18-25-43-35(38)39)45-31(47)23-16-14-12-10-8-6-4-2/h28-29H,3-27H2,1-2H3,(H,40,48)(H,41,49)(H,44,46)(H,45,47)(H4,36,37,42)(H4,38,39,43)/t28-,29-/m0/s1 |
| InChIKey | VBDDEJMTEYABEY-VMPREFPWSA-N |
| XLogP | 2.97 |
| TPSA | 245.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.01 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|