C4H11O9P3S — CID 167279571
2,4-dihydroxy-6-(2-methylsulfanylpropoxy)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide (PubChem CID 167279571) has the molecular formula C4H11O9P3S and a molecular weight of 328.11 g/mol. Its IUPAC name is 2,4-dihydroxy-6-(2-methylsulfanylpropoxy)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide.
| Compound Name | 2,4-dihydroxy-6-(2-methylsulfanylpropoxy)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
|---|---|
| PubChem CID | 167279571 |
| Molecular Formula | C4H11O9P3S |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | 2,4-dihydroxy-6-(2-methylsulfanylpropoxy)-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
| SMILES | CSC(C)COP1(=O)OP(=O)(O)OP(=O)(O)O1 |
| InChI | InChI=1S/C4H11O9P3S/c1-4(17-2)3-10-16(9)12-14(5,6)11-15(7,8)13-16/h4H,3H2,1-2H3,(H,5,6)(H,7,8) |
| InChIKey | FISJGXRNFFSZIJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|