C20H25NO2 — CID 167279757
1-(2-acetylcyclohexa-1,3-dien-1-yl)-2-(5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridin-2-yl)ethanone (PubChem CID 167279757) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(2-acetylcyclohexa-1,3-dien-1-yl)-2-(5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridin-2-yl)ethanone.
| Compound Name | 1-(2-acetylcyclohexa-1,3-dien-1-yl)-2-(5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 167279757 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-(2-acetylcyclohexa-1,3-dien-1-yl)-2-(5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridin-2-yl)ethanone |
| SMILES | CC(=O)C1=C(C(=O)CC2=NC3CCCCCC3C=C2)CCC=C1 |
| InChI | InChI=1S/C20H25NO2/c1-14(22)17-8-5-6-9-18(17)20(23)13-16-12-11-15-7-3-2-4-10-19(15)21-16/h5,8,11-12,15,19H,2-4,6-7,9-10,13H2,1H3 |
| InChIKey | HNGPQEZTNNDLFT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |