About 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane
9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane (PubChem CID 167279857) has the molecular formula C15H23F2N3O
and a molecular weight of 299.36 g/mol. Its IUPAC name is 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane |
| PubChem CID | 167279857 |
| Molecular Formula | C15H23F2N3O |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane |
| SMILES | CC(F)(F)Cn1ccnc1CN1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C15H23F2N3O/c1-14(16,17)11-20-7-6-18-13(20)10-19-8-9-21-15(12-19)4-2-3-5-15/h6-7H,2-5,8-12H2,1H3 |
| InChIKey | QZTGAXIGHSYGQK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane?
The IUPAC name of 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane (CID 167279857) is 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane.
What is the SMILES notation for 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane?
The canonical SMILES for 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane is CC(F)(F)Cn1ccnc1CN1CCOC2(CCCC2)C1.
What is the InChIKey of 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane?
The InChIKey is QZTGAXIGHSYGQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F2N3O/c1-14(16,17)11-20-7-6-18-13(20)10-19-8-9-21-15(12-19)4-2-3-5-15/h6-7H,2-5,8-12H2,1H3.
What are the key properties of 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane?
9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane has a molecular weight of 299.36 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[[1-(2,2-difluoropropyl)imidazol-2-yl]methyl]-6-oxa-9-azaspiro[4.5]decane is sourced from PubChem (CID 167279857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).