C32H45N3O3 — CID 167279979
4-[7-[8-[(3,6-dimethyl-6-bicyclo[3.2.1]octanyl)amino]oct-1-ynyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 167279979) has the molecular formula C32H45N3O3 and a molecular weight of 519.73 g/mol. Its IUPAC name is 4-[7-[8-[(3,6-dimethyl-6-bicyclo[3.2.1]octanyl)amino]oct-1-ynyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[7-[8-[(3,6-dimethyl-6-bicyclo[3.2.1]octanyl)amino]oct-1-ynyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 167279979 |
| Molecular Formula | C32H45N3O3 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.35 |
| IUPAC Name | 4-[7-[8-[(3,6-dimethyl-6-bicyclo[3.2.1]octanyl)amino]oct-1-ynyl]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)N1Cc2c(C#CCCCCCCNC3(C)CC4CC(C)CC3C4)cccc2C1=O |
| InChI | InChI=1S/C32H45N3O3/c1-23-17-24-19-26(18-23)32(2,20-24)34-16-9-7-5-4-6-8-11-25-12-10-13-28-29(25)21-35(31(28)38)27(22-36)14-15-30(37)33-3/h10,12-13,22-24,26-27,34H,4-7,9,14-21H2,1-3H3,(H,33,37) |
| InChIKey | IKIVSGUUTXLODP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|