C34H37IN4O6 — CID 16728022
(4-nitrophenyl)methyl N-[1-[[(3R,4S)-4-hydroxy-1-(3-iodobenzoyl)-4-phenylpyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 16728022) has the molecular formula C34H37IN4O6 and a molecular weight of 724.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[[(3R,4S)-4-hydroxy-1-(3-iodobenzoyl)-4-phenylpyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-[[(3R,4S)-4-hydroxy-1-(3-iodobenzoyl)-4-phenylpyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 16728022 |
| Molecular Formula | C34H37IN4O6 |
| Molecular Weight | 724.60 g/mol |
| Exact Mass | 724.18 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[[(3R,4S)-4-hydroxy-1-(3-iodobenzoyl)-4-phenylpyrrolidin-3-yl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(C[C@@H]2CN(C(=O)c3cccc(I)c3)C[C@@]2(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H37IN4O6/c1-2-17-38(33(41)45-23-25-11-13-31(14-12-25)39(43)44)30-15-18-36(19-16-30)21-28-22-37(32(40)26-7-6-10-29(35)20-26)24-34(28,42)27-8-4-3-5-9-27/h2-14,20,28,30,42H,1,15-19,21-24H2/t28-,34-/m1/s1 |
| InChIKey | JZLHRDGJIHUHOL-XQJOSWFISA-N |
| XLogP | 5.45 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|