C47H33N5 — CID 167280512
9-[3-[2-[(3Z,5Z)-4-carbazol-9-yl-2-methylhepta-1,3,5-trien-3-yl]phenyl]-2-cyanophenyl]-3,4-dihydrocarbazole-3,6-dicarbonitrile (PubChem CID 167280512) has the molecular formula C47H33N5 and a molecular weight of 667.82 g/mol. Its IUPAC name is 9-[3-[2-[(3Z,5Z)-4-carbazol-9-yl-2-methylhepta-1,3,5-trien-3-yl]phenyl]-2-cyanophenyl]-3,4-dihydrocarbazole-3,6-dicarbonitrile.
| Compound Name | 9-[3-[2-[(3Z,5Z)-4-carbazol-9-yl-2-methylhepta-1,3,5-trien-3-yl]phenyl]-2-cyanophenyl]-3,4-dihydrocarbazole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 167280512 |
| Molecular Formula | C47H33N5 |
| Molecular Weight | 667.82 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | 9-[3-[2-[(3Z,5Z)-4-carbazol-9-yl-2-methylhepta-1,3,5-trien-3-yl]phenyl]-2-cyanophenyl]-3,4-dihydrocarbazole-3,6-dicarbonitrile |
| SMILES | C=C(C)/C(=C(/C=C\C)n1c2ccccc2c2ccccc21)c1ccccc1-c1cccc(-n2c3c(c4cc(C#N)ccc42)CC(C#N)C=C3)c1C#N |
| InChI | InChI=1S/C47H33N5/c1-4-12-46(52-41-18-9-7-14-35(41)36-15-8-10-19-42(36)52)47(30(2)3)37-16-6-5-13-33(37)34-17-11-20-43(40(34)29-50)51-44-23-21-31(27-48)25-38(44)39-26-32(28-49)22-24-45(39)51/h4-25,32H,2,26H2,1,3H3/b12-4-,47-46- |
| InChIKey | CWHJSNFPXFWFOG-KNXGHNIASA-N |
| XLogP | 11.38 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.82 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|