C18H15NO6 — CID 16728054
4-(2,7-dimethyl-5-oxo-5a,9a-dihydrochromeno[2,3-b]pyridin-3-yl)-2,4-dioxobutanoic acid (PubChem CID 16728054) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is 4-(2,7-dimethyl-5-oxo-5a,9a-dihydrochromeno[2,3-b]pyridin-3-yl)-2,4-dioxobutanoic acid.
| Compound Name | 4-(2,7-dimethyl-5-oxo-5a,9a-dihydrochromeno[2,3-b]pyridin-3-yl)-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 16728054 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-(2,7-dimethyl-5-oxo-5a,9a-dihydrochromeno[2,3-b]pyridin-3-yl)-2,4-dioxobutanoic acid |
| SMILES | CC1=CC2C(=O)c3cc(C(=O)CC(=O)C(=O)O)c(C)nc3OC2C=C1 |
| InChI | InChI=1S/C18H15NO6/c1-8-3-4-15-11(5-8)16(22)12-6-10(9(2)19-17(12)25-15)13(20)7-14(21)18(23)24/h3-6,11,15H,7H2,1-2H3,(H,23,24) |
| InChIKey | JABBQOGQGITBHR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|