C47H31N5 — CID 167280596
1-[3-cyano-4-[3-[2-(2-methyl-1,2-dihydrocarbazol-9-yl)phenyl]phenyl]phenyl]-3-[(E)-1-cyanoprop-1-enyl]-2-ethynylindole-5-carbonitrile (PubChem CID 167280596) has the molecular formula C47H31N5 and a molecular weight of 665.80 g/mol. Its IUPAC name is 1-[3-cyano-4-[3-[2-(2-methyl-1,2-dihydrocarbazol-9-yl)phenyl]phenyl]phenyl]-3-[(E)-1-cyanoprop-1-enyl]-2-ethynylindole-5-carbonitrile.
| Compound Name | 1-[3-cyano-4-[3-[2-(2-methyl-1,2-dihydrocarbazol-9-yl)phenyl]phenyl]phenyl]-3-[(E)-1-cyanoprop-1-enyl]-2-ethynylindole-5-carbonitrile |
|---|---|
| PubChem CID | 167280596 |
| Molecular Formula | C47H31N5 |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | 1-[3-cyano-4-[3-[2-(2-methyl-1,2-dihydrocarbazol-9-yl)phenyl]phenyl]phenyl]-3-[(E)-1-cyanoprop-1-enyl]-2-ethynylindole-5-carbonitrile |
| SMILES | C#Cc1c(/C(C#N)=C\C)c2cc(C#N)ccc2n1-c1ccc(-c2cccc(-c3ccccc3-n3c4c(c5ccccc53)C=CC(C)C4)c2)c(C#N)c1 |
| InChI | InChI=1S/C47H31N5/c1-4-32(28-49)47-41-24-31(27-48)18-22-45(41)51(42(47)5-2)36-19-21-37(35(26-36)29-50)33-11-10-12-34(25-33)38-13-6-8-15-43(38)52-44-16-9-7-14-39(44)40-20-17-30(3)23-46(40)52/h2,4,6-22,24-26,30H,23H2,1,3H3/b32-4- |
| InChIKey | OJEURLULDBHURP-PCXLXRRESA-N |
| XLogP | 10.77 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|