C21H19BrO6 — CID 16728087
(7S,11S)-7-(4-bromophenyl)-11-(furan-2-yl)-3,3-dimethyl-2,4-dioxaspiro[5.5]undecane-1,5,9-trione (PubChem CID 16728087) has the molecular formula C21H19BrO6 and a molecular weight of 447.28 g/mol. Its IUPAC name is (7S,11S)-7-(4-bromophenyl)-11-(furan-2-yl)-3,3-dimethyl-2,4-dioxaspiro[5.5]undecane-1,5,9-trione.
| Compound Name | (7S,11S)-7-(4-bromophenyl)-11-(furan-2-yl)-3,3-dimethyl-2,4-dioxaspiro[5.5]undecane-1,5,9-trione |
|---|---|
| PubChem CID | 16728087 |
| Molecular Formula | C21H19BrO6 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | (7S,11S)-7-(4-bromophenyl)-11-(furan-2-yl)-3,3-dimethyl-2,4-dioxaspiro[5.5]undecane-1,5,9-trione |
| SMILES | CC1(C)OC(=O)C2(C(=O)O1)[C@@H](c1ccco1)CC(=O)C[C@H]2c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrO6/c1-20(2)27-18(24)21(19(25)28-20)15(12-5-7-13(22)8-6-12)10-14(23)11-16(21)17-4-3-9-26-17/h3-9,15-16H,10-11H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | JUNQQSGATWWXHD-JKSUJKDBSA-N |
| XLogP | 4.09 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|