C19H11F6NO — CID 16728098
1-[4-[2,8-bis(trifluoromethyl)quinolin-4-yl]phenyl]ethanone (PubChem CID 16728098) has the molecular formula C19H11F6NO and a molecular weight of 383.29 g/mol. Its IUPAC name is 1-[4-[2,8-bis(trifluoromethyl)quinolin-4-yl]phenyl]ethanone.
| Compound Name | 1-[4-[2,8-bis(trifluoromethyl)quinolin-4-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 16728098 |
| Molecular Formula | C19H11F6NO |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 1-[4-[2,8-bis(trifluoromethyl)quinolin-4-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)cc1 |
| InChI | InChI=1S/C19H11F6NO/c1-10(27)11-5-7-12(8-6-11)14-9-16(19(23,24)25)26-17-13(14)3-2-4-15(17)18(20,21)22/h2-9H,1H3 |
| InChIKey | BBQKWYKFZMIBPR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |