C17H11F6N3 — CID 16728101
N-(pyridin-2-ylmethyl)-2,8-bis(trifluoromethyl)quinolin-4-amine (PubChem CID 16728101) has the molecular formula C17H11F6N3 and a molecular weight of 371.28 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-2,8-bis(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-(pyridin-2-ylmethyl)-2,8-bis(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 16728101 |
| Molecular Formula | C17H11F6N3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-2,8-bis(trifluoromethyl)quinolin-4-amine |
| SMILES | FC(F)(F)c1cc(NCc2ccccn2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C17H11F6N3/c18-16(19,20)12-6-3-5-11-13(25-9-10-4-1-2-7-24-10)8-14(17(21,22)23)26-15(11)12/h1-8H,9H2,(H,25,26) |
| InChIKey | FUHSHZFIGWVNMR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |