About 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine
4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine (PubChem CID 16728105) has the molecular formula C15H12F6N2O
and a molecular weight of 350.26 g/mol. Its IUPAC name is 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine.
Molecular Properties
| Compound Name | 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine |
| PubChem CID | 16728105 |
| Molecular Formula | C15H12F6N2O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine |
| SMILES | FC(F)(F)c1cc(N2CCOCC2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C15H12F6N2O/c16-14(17,18)10-3-1-2-9-11(23-4-6-24-7-5-23)8-12(15(19,20)21)22-13(9)10/h1-3,8H,4-7H2 |
| InChIKey | KGLHWLQRMULYDW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine?
The IUPAC name of 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine (CID 16728105) is 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine.
What is the SMILES notation for 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine?
The canonical SMILES for 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine is FC(F)(F)c1cc(N2CCOCC2)c2cccc(C(F)(F)F)c2n1.
What is the InChIKey of 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine?
The InChIKey is KGLHWLQRMULYDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F6N2O/c16-14(17,18)10-3-1-2-9-11(23-4-6-24-7-5-23)8-12(15(19,20)21)22-13(9)10/h1-3,8H,4-7H2.
What are the key properties of 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine?
4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine has a molecular weight of 350.26 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,8-bis(trifluoromethyl)quinolin-4-yl]morpholine is sourced from PubChem (CID 16728105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).