C23H32N4 — CID 167281226
1,5-dimethyl-N-[(3Z,5E,7E)-7-[(E)-1-(4-methylcyclopenta-1,3-dien-1-yl)ethylidenehydrazinylidene]octa-1,3,5-trien-4-yl]-3,4-dihydro-2H-pyridin-2-amine (PubChem CID 167281226) has the molecular formula C23H32N4 and a molecular weight of 364.54 g/mol. Its IUPAC name is 1,5-dimethyl-N-[(3Z,5E,7E)-7-[(E)-1-(4-methylcyclopenta-1,3-dien-1-yl)ethylidenehydrazinylidene]octa-1,3,5-trien-4-yl]-3,4-dihydro-2H-pyridin-2-amine.
| Compound Name | 1,5-dimethyl-N-[(3Z,5E,7E)-7-[(E)-1-(4-methylcyclopenta-1,3-dien-1-yl)ethylidenehydrazinylidene]octa-1,3,5-trien-4-yl]-3,4-dihydro-2H-pyridin-2-amine |
|---|---|
| PubChem CID | 167281226 |
| Molecular Formula | C23H32N4 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 1,5-dimethyl-N-[(3Z,5E,7E)-7-[(E)-1-(4-methylcyclopenta-1,3-dien-1-yl)ethylidenehydrazinylidene]octa-1,3,5-trien-4-yl]-3,4-dihydro-2H-pyridin-2-amine |
| SMILES | C=C/C=C(/C=C/C(C)=N/N=C(\C)C1=CC=C(C)C1)NC1CCC(C)=CN1C |
| InChI | InChI=1S/C23H32N4/c1-7-8-22(24-23-14-10-18(3)16-27(23)6)13-11-19(4)25-26-20(5)21-12-9-17(2)15-21/h7-9,11-13,16,23-24H,1,10,14-15H2,2-6H3/b13-11+,22-8-,25-19+,26-20+ |
| InChIKey | UQYDUQVDYVGALK-MXMCVOPBSA-N |
| XLogP | 5.27 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|