C16H18F2S — CID 167281450
(3Z,7Z,9E)-10-fluoro-3-[(1Z,3E)-4-fluoropenta-1,3-dienyl]-6-methylidene-1-thiacycloundeca-3,7,9-triene (PubChem CID 167281450) has the molecular formula C16H18F2S and a molecular weight of 280.38 g/mol. Its IUPAC name is (3Z,7Z,9E)-10-fluoro-3-[(1Z,3E)-4-fluoropenta-1,3-dienyl]-6-methylidene-1-thiacycloundeca-3,7,9-triene.
| Compound Name | (3Z,7Z,9E)-10-fluoro-3-[(1Z,3E)-4-fluoropenta-1,3-dienyl]-6-methylidene-1-thiacycloundeca-3,7,9-triene |
|---|---|
| PubChem CID | 167281450 |
| Molecular Formula | C16H18F2S |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (3Z,7Z,9E)-10-fluoro-3-[(1Z,3E)-4-fluoropenta-1,3-dienyl]-6-methylidene-1-thiacycloundeca-3,7,9-triene |
| SMILES | C=C1/C=C\C=C(\F)CSCC(/C=C\C=C(/C)F)=C\C1 |
| InChI | InChI=1S/C16H18F2S/c1-13-5-3-8-16(18)12-19-11-15(10-9-13)7-4-6-14(2)17/h3-8,10H,1,9,11-12H2,2H3/b5-3-,7-4-,14-6+,15-10-,16-8+ |
| InChIKey | ITAFUGMXDQATKR-YPXMLWGGSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|