C19H30F2N2 — CID 167281600
5-ethyl-3-[[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]amino]-7,7-difluoro-5-methylheptanenitrile (PubChem CID 167281600) has the molecular formula C19H30F2N2 and a molecular weight of 324.46 g/mol. Its IUPAC name is 5-ethyl-3-[[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]amino]-7,7-difluoro-5-methylheptanenitrile.
| Compound Name | 5-ethyl-3-[[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]amino]-7,7-difluoro-5-methylheptanenitrile |
|---|---|
| PubChem CID | 167281600 |
| Molecular Formula | C19H30F2N2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 5-ethyl-3-[[(3Z,4Z)-3-ethylidenehepta-4,6-dienyl]amino]-7,7-difluoro-5-methylheptanenitrile |
| SMILES | C=C/C=C\C(=C/C)CCNC(CC#N)CC(C)(CC)CC(F)F |
| InChI | InChI=1S/C19H30F2N2/c1-5-8-9-16(6-2)11-13-23-17(10-12-22)14-19(4,7-3)15-18(20)21/h5-6,8-9,17-18,23H,1,7,10-11,13-15H2,2-4H3/b9-8-,16-6+ |
| InChIKey | KQHNULXGCKOVLN-IHACMCCQSA-N |
| XLogP | 5.40 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|