About (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine
(3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine (PubChem CID 167281745) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine.
Molecular Properties
| Compound Name | (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine |
| PubChem CID | 167281745 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine |
| SMILES | C=c1/c(=C\C=C/C)c2c(n1N)C=CCC2 |
| InChI | InChI=1S/C13H16N2/c1-3-4-7-11-10(2)15(14)13-9-6-5-8-12(11)13/h3-4,6-7,9H,2,5,8,14H2,1H3/b4-3-,11-7+ |
| InChIKey | JOULPFRFRWILQF-CCBPTBINSA-N |
| XLogP | 0.93 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine?
The IUPAC name of (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine (CID 167281745) is (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine.
What is the SMILES notation for (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine?
The canonical SMILES for (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine is C=c1/c(=C\C=C/C)c2c(n1N)C=CCC2.
What is the InChIKey of (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine?
The InChIKey is JOULPFRFRWILQF-CCBPTBINSA-N. The full InChI is InChI=1S/C13H16N2/c1-3-4-7-11-10(2)15(14)13-9-6-5-8-12(11)13/h3-4,6-7,9H,2,5,8,14H2,1H3/b4-3-,11-7+.
What are the key properties of (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine?
(3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine has a molecular weight of 200.28 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(Z)-but-2-enylidene]-2-methylidene-4,5-dihydroindol-1-amine is sourced from PubChem (CID 167281745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).